C8H13NO2S2 — CID 172767635
(4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylic acid (PubChem CID 172767635) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylic acid.
| Compound Name | (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 172767635 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@@H]2CSSC[C@H]21 |
| InChI | InChI=1S/C8H13NO2S2/c10-8(11)9-3-1-2-6-4-12-13-5-7(6)9/h6-7H,1-5H2,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | MNJLWQMOTHKAAP-RNFRBKRXSA-N |
| XLogP | 2.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|