C8H13ClN2OS2 — CID 174186508
N-(3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridin-1-yl)carbamoyl chloride (PubChem CID 174186508) has the molecular formula C8H13ClN2OS2 and a molecular weight of 252.79 g/mol. Its IUPAC name is N-(3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridin-1-yl)carbamoyl chloride.
| Compound Name | N-(3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridin-1-yl)carbamoyl chloride |
|---|---|
| PubChem CID | 174186508 |
| Molecular Formula | C8H13ClN2OS2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | N-(3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridin-1-yl)carbamoyl chloride |
| SMILES | O=C(Cl)NN1CCCC2CSSCC21 |
| InChI | InChI=1S/C8H13ClN2OS2/c9-8(12)10-11-3-1-2-6-4-13-14-5-7(6)11/h6-7H,1-5H2,(H,10,12) |
| InChIKey | GYFUHDNTHGCXBQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|