C11H16N2O6S — CID 172768099
2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid (PubChem CID 172768099) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid.
| Compound Name | 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid |
|---|---|
| PubChem CID | 172768099 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.NC(=O)COc1ccccc1C(N)=O |
| InChI | InChI=1S/C9H10N2O3.C2H6O3S/c10-8(12)5-14-7-4-2-1-3-6(7)9(11)13;1-2-6(3,4)5/h1-4H,5H2,(H2,10,12)(H2,11,13);2H2,1H3,(H,3,4,5) |
| InChIKey | MOWVQJINBSTLFU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|