2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid

C11H16N2O6S — CID 172768099

IUPAC2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid
SMILESCCS(=O)(=O)O.NC(=O)COc1ccccc1C(N)=O
InChIInChI=1S/C9H10N2O3.C2H6O3S/c10-8(12)5-14-7-4-2-1-3-6(7)9(11)13;1-2-6(3,4)5/h1-4H,5H2,(H2,10,12)(H2,11,13);2H2,1H3,(H,3,4,5)
InChIKeyMOWVQJINBSTLFU-UHFFFAOYSA-N
MW304.32 g/mol
LogP-0.46
Rot. Bonds5

About 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid

2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid (PubChem CID 172768099) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid.

Molecular Properties

Compound Name2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid
PubChem CID172768099
Molecular FormulaC11H16N2O6S
Molecular Weight304.32 g/mol
Exact Mass304.07
IUPAC Name2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid
SMILESCCS(=O)(=O)O.NC(=O)COc1ccccc1C(N)=O
InChIInChI=1S/C9H10N2O3.C2H6O3S/c10-8(12)5-14-7-4-2-1-3-6(7)9(11)13;1-2-6(3,4)5/h1-4H,5H2,(H2,10,12)(H2,11,13);2H2,1H3,(H,3,4,5)
InChIKeyMOWVQJINBSTLFU-UHFFFAOYSA-N
XLogP-0.46
TPSA149.78 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.32
LogP ≤ 5-0.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid?
The IUPAC name of 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid (CID 172768099) is 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid.
What is the SMILES notation for 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid?
The canonical SMILES for 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid is CCS(=O)(=O)O.NC(=O)COc1ccccc1C(N)=O.
What is the InChIKey of 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid?
The InChIKey is MOWVQJINBSTLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3.C2H6O3S/c10-8(12)5-14-7-4-2-1-3-6(7)9(11)13;1-2-6(3,4)5/h1-4H,5H2,(H2,10,12)(H2,11,13);2H2,1H3,(H,3,4,5).
What are the key properties of 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid?
2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid has a molecular weight of 304.32 g/mol, XLogP of -0.46, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-2-oxoethoxy)benzamide;ethanesulfonic acid is sourced from PubChem (CID 172768099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).