About dimethyl propanedioate;methanesulfonic acid
dimethyl propanedioate;methanesulfonic acid (PubChem CID 172769091) has the molecular formula C6H12O7S
and a molecular weight of 228.22 g/mol. Its IUPAC name is dimethyl propanedioate;methanesulfonic acid.
Molecular Properties
| Compound Name | dimethyl propanedioate;methanesulfonic acid |
| PubChem CID | 172769091 |
| Molecular Formula | C6H12O7S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | dimethyl propanedioate;methanesulfonic acid |
| SMILES | COC(=O)CC(=O)OC.CS(=O)(=O)O |
| InChI | InChI=1S/C5H8O4.CH4O3S/c1-8-4(6)3-5(7)9-2;1-5(2,3)4/h3H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | MSCIGVUOEXYKIV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl propanedioate;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl propanedioate;methanesulfonic acid?
The IUPAC name of dimethyl propanedioate;methanesulfonic acid (CID 172769091) is dimethyl propanedioate;methanesulfonic acid.
What is the SMILES notation for dimethyl propanedioate;methanesulfonic acid?
The canonical SMILES for dimethyl propanedioate;methanesulfonic acid is COC(=O)CC(=O)OC.CS(=O)(=O)O.
What is the InChIKey of dimethyl propanedioate;methanesulfonic acid?
The InChIKey is MSCIGVUOEXYKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.CH4O3S/c1-8-4(6)3-5(7)9-2;1-5(2,3)4/h3H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of dimethyl propanedioate;methanesulfonic acid?
dimethyl propanedioate;methanesulfonic acid has a molecular weight of 228.22 g/mol, XLogP of -0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl propanedioate;methanesulfonic acid is sourced from PubChem (CID 172769091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).