C14H25N3O2 — CID 172771797
1,2-diazacyclopentadec-14-yn-7-ylcarbamic acid (PubChem CID 172771797) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1,2-diazacyclopentadec-14-yn-7-ylcarbamic acid.
| Compound Name | 1,2-diazacyclopentadec-14-yn-7-ylcarbamic acid |
|---|---|
| PubChem CID | 172771797 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1,2-diazacyclopentadec-14-yn-7-ylcarbamic acid |
| SMILES | O=C(O)NC1CCCCCCC#CNNCCCC1 |
| InChI | InChI=1S/C14H25N3O2/c18-14(19)17-13-9-5-3-1-2-4-7-11-15-16-12-8-6-10-13/h13,15-17H,1-6,8-10,12H2,(H,18,19) |
| InChIKey | NBBJIMRUAOPHNH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|