C15H15N5O — CID 172774618
1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propan-1-ol (PubChem CID 172774618) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 172774618 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propan-1-ol |
| SMILES | CCC(O)Nc1nc(-c2ccncc2)nc2cnccc12 |
| InChI | InChI=1S/C15H15N5O/c1-2-13(21)19-15-11-5-8-17-9-12(11)18-14(20-15)10-3-6-16-7-4-10/h3-9,13,21H,2H2,1H3,(H,18,19,20) |
| InChIKey | NKLVCWDAHPPSNB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|