C15H15N5O2 — CID 172812602
1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 172812602) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propane-1,3-diol.
| Compound Name | 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 172812602 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-[(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | OCCC(O)Nc1nc(-c2ccncc2)nc2cnccc12 |
| InChI | InChI=1S/C15H15N5O2/c21-8-4-13(22)19-15-11-3-7-17-9-12(11)18-14(20-15)10-1-5-16-6-2-10/h1-3,5-7,9,13,21-22H,4,8H2,(H,18,19,20) |
| InChIKey | SJQWLQWWEIJNLN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|