About CID 172779774
CID 172779774 (PubChem CID 172779774) has the molecular formula C6H5NO3S
and a molecular weight of 171.18 g/mol.
Molecular Properties
| Compound Name | CID 172779774 |
| PubChem CID | 172779774 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | — |
| SMILES | O=C([O-])C1[CH+]S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C6H5NO3S/c8-4-1-5-7(4)3(2-11-5)6(9)10/h2-3,5H,1H2/t3?,5-/m1/s1 |
| InChIKey | OCHHPXXUIXTSGI-SDMSXHDGSA-N |
| XLogP | -1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 172779774 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172779774?
The IUPAC name of CID 172779774 (CID 172779774) is not available.
What is the SMILES notation for CID 172779774?
The canonical SMILES for CID 172779774 is O=C([O-])C1[CH+]S[C@@H]2CC(=O)N12.
What is the InChIKey of CID 172779774?
The InChIKey is OCHHPXXUIXTSGI-SDMSXHDGSA-N. The full InChI is InChI=1S/C6H5NO3S/c8-4-1-5-7(4)3(2-11-5)6(9)10/h2-3,5H,1H2/t3?,5-/m1/s1.
What are the key properties of CID 172779774?
CID 172779774 has a molecular weight of 171.18 g/mol, XLogP of -1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172779774 is sourced from PubChem (CID 172779774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).