About methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate
methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate (PubChem CID 172781506) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate.
Analyze methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate?
The IUPAC name of methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate (CID 172781506) is methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate.
What is the SMILES notation for methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate?
The canonical SMILES for methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate is COC(=O)C(N)c1cccc2c1CC2.
What is the InChIKey of methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate?
The InChIKey is OIADGNJSMHJWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-14-11(13)10(12)9-4-2-3-7-5-6-8(7)9/h2-4,10H,5-6,12H2,1H3.
What are the key properties of methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate?
methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate has a molecular weight of 191.23 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetate is sourced from PubChem (CID 172781506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).