C8H12N3O2+ — CID 143359556
methyl 2-amino-2-(2-aminopyridin-1-ium-3-yl)acetate (PubChem CID 143359556) has the molecular formula C8H12N3O2+ and a molecular weight of 182.20 g/mol. Its IUPAC name is methyl 2-amino-2-(2-aminopyridin-1-ium-3-yl)acetate.
| Compound Name | methyl 2-amino-2-(2-aminopyridin-1-ium-3-yl)acetate |
|---|---|
| PubChem CID | 143359556 |
| Molecular Formula | C8H12N3O2+ |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | methyl 2-amino-2-(2-aminopyridin-1-ium-3-yl)acetate |
| SMILES | COC(=O)C(N)c1ccc[nH+]c1N |
| InChI | InChI=1S/C8H11N3O2/c1-13-8(12)6(9)5-3-2-4-11-7(5)10/h2-4,6H,9H2,1H3,(H2,10,11)/p+1 |
| InChIKey | JXYUZABAIOUBGU-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |