C8H24O7P2S2 — CID 172782020
dihydroxy-octan-3-ylsulfanyl-sulfanylidene-λ5-phosphane;phosphoric acid;hydrate (PubChem CID 172782020) has the molecular formula C8H24O7P2S2 and a molecular weight of 358.36 g/mol. Its IUPAC name is dihydroxy-octan-3-ylsulfanyl-sulfanylidene-λ5-phosphane;phosphoric acid;hydrate.
| Compound Name | dihydroxy-octan-3-ylsulfanyl-sulfanylidene-λ5-phosphane;phosphoric acid;hydrate |
|---|---|
| PubChem CID | 172782020 |
| Molecular Formula | C8H24O7P2S2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | dihydroxy-octan-3-ylsulfanyl-sulfanylidene-λ5-phosphane;phosphoric acid;hydrate |
| SMILES | CCCCCC(CC)SP(O)(O)=S.O.O=P(O)(O)O |
| InChI | InChI=1S/C8H19O2PS2.H3O4P.H2O/c1-3-5-6-7-8(4-2)13-11(9,10)12;1-5(2,3)4;/h8H,3-7H2,1-2H3,(H2,9,10,12);(H3,1,2,3,4);1H2 |
| InChIKey | UJNNLTZROAVJBV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|