C33H39N5O — CID 172782612
4'-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2'-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)spiro[1H-acenaphthylene-2,7'-6,8-dihydro-5H-quinazoline] (PubChem CID 172782612) has the molecular formula C33H39N5O and a molecular weight of 521.71 g/mol. Its IUPAC name is 4'-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2'-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)spiro[1H-acenaphthylene-2,7'-6,8-dihydro-5H-quinazoline].
| Compound Name | 4'-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2'-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)spiro[1H-acenaphthylene-2,7'-6,8-dihydro-5H-quinazoline] |
|---|---|
| PubChem CID | 172782612 |
| Molecular Formula | C33H39N5O |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | 4'-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2'-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)spiro[1H-acenaphthylene-2,7'-6,8-dihydro-5H-quinazoline] |
| SMILES | c1cc2c3c(cccc3c1)C1(CCc3c(nc(OCC45CCCN4CCC5)nc3N3C[C@H]4CC[C@@H](C3)N4)C1)C2 |
| InChI | InChI=1S/C33H39N5O/c1-5-22-6-2-8-27-29(22)23(7-1)17-32(27)14-11-26-28(18-32)35-31(39-21-33-12-3-15-38(33)16-4-13-33)36-30(26)37-19-24-9-10-25(20-37)34-24/h1-2,5-8,24-25,34H,3-4,9-21H2/t24-,25+,32? |
| InChIKey | OLQNFSQNEFPNMT-FCLIONODSA-N |
| XLogP | 4.56 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |