C9H12NO4S+ — CID 172789484
(5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-4-thionia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 172789484) has the molecular formula C9H12NO4S+ and a molecular weight of 230.26 g/mol. Its IUPAC name is (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-4-thionia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-4-thionia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 172789484 |
| Molecular Formula | C9H12NO4S+ |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-4-thionia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)C1C(=O)N2C(C(=O)O)=C[S+](C)[C@H]12 |
| InChI | InChI=1S/C9H11NO4S/c1-4(11)6-7(12)10-5(9(13)14)3-15(2)8(6)10/h3-4,6,8,11H,1-2H3/p+1/t4-,6?,8-,15?/m1/s1 |
| InChIKey | PJAYEAPSGCEZHT-GJAGTZDDSA-O |
| XLogP | -0.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|