C10H12NNaO4 — CID 67833474
sodium 6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 67833474) has the molecular formula C10H12NNaO4 and a molecular weight of 233.20 g/mol. Its IUPAC name is sodium 6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium 6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67833474 |
| Molecular Formula | C10H12NNaO4 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | sodium 6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(O)C1C(=O)N2C(C(=O)[O-])=CC(C)C12.[Na+] |
| InChI | InChI=1S/C10H13NO4.Na/c1-4-3-6(10(14)15)11-8(4)7(5(2)12)9(11)13;/h3-5,7-8,12H,1-2H3,(H,14,15);/q;+1/p-1 |
| InChIKey | RIXFEPKIRJODPT-UHFFFAOYSA-M |
| XLogP | -4.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |