C18H18N3NaO6S — CID 23665175
sodium (4S,5R,6S)-3-[(1,1-dioxo-1λ6,2,3-benzothiadiazin-2-yl)methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23665175) has the molecular formula C18H18N3NaO6S and a molecular weight of 427.41 g/mol. Its IUPAC name is sodium (4S,5R,6S)-3-[(1,1-dioxo-1λ6,2,3-benzothiadiazin-2-yl)methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium (4S,5R,6S)-3-[(1,1-dioxo-1λ6,2,3-benzothiadiazin-2-yl)methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23665175 |
| Molecular Formula | C18H18N3NaO6S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | sodium (4S,5R,6S)-3-[(1,1-dioxo-1λ6,2,3-benzothiadiazin-2-yl)methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C(CN3N=Cc4ccccc4S3(=O)=O)[C@H](C)[C@H]12.[Na+] |
| InChI | InChI=1S/C18H19N3O6S.Na/c1-9-12(16(18(24)25)21-15(9)14(10(2)22)17(21)23)8-20-19-7-11-5-3-4-6-13(11)28(20,26)27;/h3-7,9-10,14-15,22H,8H2,1-2H3,(H,24,25);/q;+1/p-1/t9-,10+,14+,15+;/m0./s1 |
| InChIKey | FAROYPYEYAYMCW-OYPHEYAWSA-M |
| XLogP | -4.11 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |