About 9H-pyrido[2,1-b]quinazoline;hydrochloride
9H-pyrido[2,1-b]quinazoline;hydrochloride (PubChem CID 172790321) has the molecular formula C12H11ClN2
and a molecular weight of 218.69 g/mol. Its IUPAC name is 9H-pyrido[2,1-b]quinazoline;hydrochloride.
Molecular Properties
| Compound Name | 9H-pyrido[2,1-b]quinazoline;hydrochloride |
| PubChem CID | 172790321 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 9H-pyrido[2,1-b]quinazoline;hydrochloride |
| SMILES | C1=CCN2C=c3ccccc3=NC2=C1.Cl |
| InChI | InChI=1S/C12H10N2.ClH/c1-2-6-11-10(5-1)9-14-8-4-3-7-12(14)13-11;/h1-7,9H,8H2;1H |
| InChIKey | PMCJCUQENSBEQF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-pyrido[2,1-b]quinazoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrido[2,1-b]quinazoline;hydrochloride?
The IUPAC name of 9H-pyrido[2,1-b]quinazoline;hydrochloride (CID 172790321) is 9H-pyrido[2,1-b]quinazoline;hydrochloride.
What is the SMILES notation for 9H-pyrido[2,1-b]quinazoline;hydrochloride?
The canonical SMILES for 9H-pyrido[2,1-b]quinazoline;hydrochloride is C1=CCN2C=c3ccccc3=NC2=C1.Cl.
What is the InChIKey of 9H-pyrido[2,1-b]quinazoline;hydrochloride?
The InChIKey is PMCJCUQENSBEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2.ClH/c1-2-6-11-10(5-1)9-14-8-4-3-7-12(14)13-11;/h1-7,9H,8H2;1H.
What are the key properties of 9H-pyrido[2,1-b]quinazoline;hydrochloride?
9H-pyrido[2,1-b]quinazoline;hydrochloride has a molecular weight of 218.69 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrido[2,1-b]quinazoline;hydrochloride is sourced from PubChem (CID 172790321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).