C22H23N5O — CID 172793470
1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-imine (PubChem CID 172793470) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-imine.
| Compound Name | 1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-imine |
|---|---|
| PubChem CID | 172793470 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-imine |
| SMILES | [H]/N=C1\Cc2ccccc2-n2c(nnc2C2CCC(Oc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C22H23N5O/c23-17-13-16-5-1-2-6-19(16)27-20(14-17)25-26-22(27)15-8-10-18(11-9-15)28-21-7-3-4-12-24-21/h1-7,12,15,18,23H,8-11,13-14H2/b23-17+ |
| InChIKey | PWQOQIKESNHXHB-HAVVHWLPSA-N |
| XLogP | 3.89 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|