C22H28NO5P — CID 172796094
[3-methyl-5-[methyl-(3-methyl-5-naphthalen-2-ylpent-2-enyl)amino]-2-oxooxolan-3-yl]phosphonic acid (PubChem CID 172796094) has the molecular formula C22H28NO5P and a molecular weight of 417.44 g/mol. Its IUPAC name is [3-methyl-5-[methyl-(3-methyl-5-naphthalen-2-ylpent-2-enyl)amino]-2-oxooxolan-3-yl]phosphonic acid.
| Compound Name | [3-methyl-5-[methyl-(3-methyl-5-naphthalen-2-ylpent-2-enyl)amino]-2-oxooxolan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 172796094 |
| Molecular Formula | C22H28NO5P |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [3-methyl-5-[methyl-(3-methyl-5-naphthalen-2-ylpent-2-enyl)amino]-2-oxooxolan-3-yl]phosphonic acid |
| SMILES | CC(=CCN(C)C1CC(C)(P(=O)(O)O)C(=O)O1)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H28NO5P/c1-16(8-9-17-10-11-18-6-4-5-7-19(18)14-17)12-13-23(3)20-15-22(2,21(24)28-20)29(25,26)27/h4-7,10-12,14,20H,8-9,13,15H2,1-3H3,(H2,25,26,27) |
| InChIKey | FIPVWLORQFCROE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|