C18H20Na2O6S — CID 172797758
disodium;(9R,10R,13S,14S)-3-hydroxy-13-methyl-10,11,12,14,15,16-hexahydro-9H-cyclopenta[a]phenanthren-17-one;sulfate (PubChem CID 172797758) has the molecular formula C18H20Na2O6S and a molecular weight of 410.40 g/mol. Its IUPAC name is disodium;(9R,10R,13S,14S)-3-hydroxy-13-methyl-10,11,12,14,15,16-hexahydro-9H-cyclopenta[a]phenanthren-17-one;sulfate.
| Compound Name | disodium;(9R,10R,13S,14S)-3-hydroxy-13-methyl-10,11,12,14,15,16-hexahydro-9H-cyclopenta[a]phenanthren-17-one;sulfate |
|---|---|
| PubChem CID | 172797758 |
| Molecular Formula | C18H20Na2O6S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | disodium;(9R,10R,13S,14S)-3-hydroxy-13-methyl-10,11,12,14,15,16-hexahydro-9H-cyclopenta[a]phenanthren-17-one;sulfate |
| SMILES | C[C@]12CC[C@H]3C(=CC=C4C=C(O)C=C[C@@H]43)[C@@H]1CCC2=O.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C18H20O2.2Na.H2O4S/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;;;1-5(2,3)4/h2-5,10,13-14,16,19H,6-9H2,1H3;;;(H2,1,2,3,4)/q;2*+1;/p-2/t13-,14+,16-,18-;;;/m0.../s1 |
| InChIKey | QLCWZSJJNCNSLX-BMAAGIOGSA-L |
| XLogP | -3.45 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|