C18H18O3 — CID 100956547
(9S,13S,14S)-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,4,17-trione (PubChem CID 100956547) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (9S,13S,14S)-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,4,17-trione.
| Compound Name | (9S,13S,14S)-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,4,17-trione |
|---|---|
| PubChem CID | 100956547 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (9S,13S,14S)-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,4,17-trione |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=O)C4=O)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H18O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h2,4,6,11,14H,3,5,7-9H2,1H3/t11-,14+,18+/m1/s1 |
| InChIKey | XQBCFXCLYSJNHZ-VZSAFFHGSA-N |
| XLogP | 2.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|