C19H26O2 — CID 11673656
(1S,5S,13R)-5-methyltetracyclo[11.4.1.02,10.05,9]octadec-16-ene-6,15-dione (PubChem CID 11673656) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (1S,5S,13R)-5-methyltetracyclo[11.4.1.02,10.05,9]octadec-16-ene-6,15-dione.
| Compound Name | (1S,5S,13R)-5-methyltetracyclo[11.4.1.02,10.05,9]octadec-16-ene-6,15-dione |
|---|---|
| PubChem CID | 11673656 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1S,5S,13R)-5-methyltetracyclo[11.4.1.02,10.05,9]octadec-16-ene-6,15-dione |
| SMILES | C[C@]12CCC3C(CC[C@H]4CC(=O)C=C[C@@H]3C4)C1CCC2=O |
| InChI | InChI=1S/C19H26O2/c1-19-9-8-15-13-3-4-14(20)11-12(10-13)2-5-16(15)17(19)6-7-18(19)21/h3-4,12-13,15-17H,2,5-11H2,1H3/t12-,13-,15?,16?,17?,19+/m1/s1 |
| InChIKey | WKZMKQUATABLSM-BOCSSKSBSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |