C19H28O2 — CID 102029898
(1R,2S,6Z,10R,11S,15S)-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-6-ene-5,14-dione (PubChem CID 102029898) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,2S,6Z,10R,11S,15S)-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-6-ene-5,14-dione.
| Compound Name | (1R,2S,6Z,10R,11S,15S)-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-6-ene-5,14-dione |
|---|---|
| PubChem CID | 102029898 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,2S,6Z,10R,11S,15S)-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-6-ene-5,14-dione |
| SMILES | C[C@H]1CCC(=O)/C=C\CC[C@@H]2[C@@H]1CC[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C19H28O2/c1-13-7-8-14(20)5-3-4-6-16-15(13)11-12-19(2)17(16)9-10-18(19)21/h3,5,13,15-17H,4,6-12H2,1-2H3/b5-3-/t13-,15+,16+,17-,19-/m0/s1 |
| InChIKey | XRTYQULKTAGZTQ-SYFBHZATSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |