C19H27NO2 — CID 57385148
(2R,11S,12S,16S)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-5-ene-7,15-dione (PubChem CID 57385148) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (2R,11S,12S,16S)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-5-ene-7,15-dione.
| Compound Name | (2R,11S,12S,16S)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-5-ene-7,15-dione |
|---|---|
| PubChem CID | 57385148 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2R,11S,12S,16S)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-5-ene-7,15-dione |
| SMILES | C[C@]12CCC3[C@@H](CCN4C(=O)C=CCC[C@]34C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H27NO2/c1-18-11-8-15-13(14(18)6-7-16(18)21)9-12-20-17(22)5-3-4-10-19(15,20)2/h3,5,13-15H,4,6-12H2,1-2H3/t13-,14-,15?,18-,19+/m0/s1 |
| InChIKey | KHAAGLJMGXLWSE-XPIDSFGASA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |