C18H29NO2 — CID 102363946
(3aS,3bS,8S,10aR,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-3,3a,3b,4,5,7,8,9,10,10b,11,12-dodecahydro-2H-indeno[5,4-a]quinolizin-1-one (PubChem CID 102363946) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is (3aS,3bS,8S,10aR,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-3,3a,3b,4,5,7,8,9,10,10b,11,12-dodecahydro-2H-indeno[5,4-a]quinolizin-1-one.
| Compound Name | (3aS,3bS,8S,10aR,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-3,3a,3b,4,5,7,8,9,10,10b,11,12-dodecahydro-2H-indeno[5,4-a]quinolizin-1-one |
|---|---|
| PubChem CID | 102363946 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (3aS,3bS,8S,10aR,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-3,3a,3b,4,5,7,8,9,10,10b,11,12-dodecahydro-2H-indeno[5,4-a]quinolizin-1-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCN4C[C@@H](O)CC[C@]34C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H29NO2/c1-17-8-6-15-13(14(17)3-4-16(17)21)7-10-19-11-12(20)5-9-18(15,19)2/h12-15,20H,3-11H2,1-2H3/t12-,13-,14-,15-,17-,18+/m0/s1 |
| InChIKey | ISRJCXPXIGSKGU-OZINRZGZSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |