C36H46N2O3S — CID 172800687
1'-[(1R,2S,4S)-4-methyl-2-propan-2-ylcyclohexyl]-6-[4-(pyridin-2-ylmethylsulfonylmethyl)phenyl]spiro[3,4-dihydrochromene-2,4'-piperidine] (PubChem CID 172800687) has the molecular formula C36H46N2O3S and a molecular weight of 586.84 g/mol. Its IUPAC name is 1'-[(1R,2S,4S)-4-methyl-2-propan-2-ylcyclohexyl]-6-[4-(pyridin-2-ylmethylsulfonylmethyl)phenyl]spiro[3,4-dihydrochromene-2,4'-piperidine].
| Compound Name | 1'-[(1R,2S,4S)-4-methyl-2-propan-2-ylcyclohexyl]-6-[4-(pyridin-2-ylmethylsulfonylmethyl)phenyl]spiro[3,4-dihydrochromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 172800687 |
| Molecular Formula | C36H46N2O3S |
| Molecular Weight | 586.84 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 1'-[(1R,2S,4S)-4-methyl-2-propan-2-ylcyclohexyl]-6-[4-(pyridin-2-ylmethylsulfonylmethyl)phenyl]spiro[3,4-dihydrochromene-2,4'-piperidine] |
| SMILES | CC(C)[C@@H]1C[C@@H](C)CC[C@H]1N1CCC2(CCc3cc(-c4ccc(CS(=O)(=O)Cc5ccccn5)cc4)ccc3O2)CC1 |
| InChI | InChI=1S/C36H46N2O3S/c1-26(2)33-22-27(3)7-13-34(33)38-20-17-36(18-21-38)16-15-31-23-30(12-14-35(31)41-36)29-10-8-28(9-11-29)24-42(39,40)25-32-6-4-5-19-37-32/h4-6,8-12,14,19,23,26-27,33-34H,7,13,15-18,20-22,24-25H2,1-3H3/t27-,33-,34+/m0/s1 |
| InChIKey | QUXABQXERCJPDG-FBBJSWSOSA-N |
| XLogP | 7.48 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.84 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |