C19H20ClFN7O3S+ — CID 172801046
N-(5-amino-1H-1,2,4-triazol-3-yl)-4-chloro-2-[(3-fluoro-5-morpholin-4-ylbenzoyl)amino]-3-methylthiophen-1-ium-1-carboxamide (PubChem CID 172801046) has the molecular formula C19H20ClFN7O3S+ and a molecular weight of 480.93 g/mol. Its IUPAC name is N-(5-amino-1H-1,2,4-triazol-3-yl)-4-chloro-2-[(3-fluoro-5-morpholin-4-ylbenzoyl)amino]-3-methylthiophen-1-ium-1-carboxamide.
| Compound Name | N-(5-amino-1H-1,2,4-triazol-3-yl)-4-chloro-2-[(3-fluoro-5-morpholin-4-ylbenzoyl)amino]-3-methylthiophen-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 172801046 |
| Molecular Formula | C19H20ClFN7O3S+ |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-(5-amino-1H-1,2,4-triazol-3-yl)-4-chloro-2-[(3-fluoro-5-morpholin-4-ylbenzoyl)amino]-3-methylthiophen-1-ium-1-carboxamide |
| SMILES | Cc1c(Cl)c[s+](C(=O)Nc2n[nH]c(N)n2)c1NC(=O)c1cc(F)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C19H19ClFN7O3S/c1-10-14(20)9-32(19(30)25-18-24-17(22)26-27-18)16(10)23-15(29)11-6-12(21)8-13(7-11)28-2-4-31-5-3-28/h6-9H,2-5H2,1H3,(H4-,22,23,24,25,26,27,29,30)/p+1 |
| InChIKey | QWDXTWZQAXYTMY-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|