C34H35FN7O4P — CID 172802400
ditert-butyl [5-[2-[2-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazol-2-yl]methyl phosphate (PubChem CID 172802400) has the molecular formula C34H35FN7O4P and a molecular weight of 655.67 g/mol. Its IUPAC name is ditert-butyl [5-[2-[2-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazol-2-yl]methyl phosphate.
| Compound Name | ditert-butyl [5-[2-[2-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazol-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 172802400 |
| Molecular Formula | C34H35FN7O4P |
| Molecular Weight | 655.67 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | ditert-butyl [5-[2-[2-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazol-2-yl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCn1cc2cc(C#Cc3ccnc(-c4ccnc(N5Cc6ccc(F)cc6C5)n4)n3)ccc2n1)OC(C)(C)C |
| InChI | InChI=1S/C34H35FN7O4P/c1-33(2,3)45-47(43,46-34(4,5)6)44-22-42-21-26-17-23(8-12-29(26)40-42)7-11-28-13-15-36-31(38-28)30-14-16-37-32(39-30)41-19-24-9-10-27(35)18-25(24)20-41/h8-10,12-18,21H,19-20,22H2,1-6H3 |
| InChIKey | RARYGOHZQFVROX-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 117.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|