C36H48N4O8 — CID 172802437
[(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidin-3-yl] isoindole-2-carboxylate (PubChem CID 172802437) has the molecular formula C36H48N4O8 and a molecular weight of 664.80 g/mol. Its IUPAC name is [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidin-3-yl] isoindole-2-carboxylate.
| Compound Name | [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidin-3-yl] isoindole-2-carboxylate |
|---|---|
| PubChem CID | 172802437 |
| Molecular Formula | C36H48N4O8 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidin-3-yl] isoindole-2-carboxylate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](OC(=O)n2cc3ccccc3c2)C[C@H]1C(=O)N[C@]1(C(=O)OCC)C[C@H]1C=C |
| InChI | InChI=1S/C36H48N4O8/c1-7-10-11-12-13-18-28(37-33(44)48-35(4,5)6)31(42)40-23-27(47-34(45)39-21-24-16-14-15-17-25(24)22-39)19-29(40)30(41)38-36(20-26(36)8-2)32(43)46-9-3/h7-8,14-17,21-22,26-29H,1-2,9-13,18-20,23H2,3-6H3,(H,37,44)(H,38,41)/t26-,27-,28+,29+,36-/m1/s1 |
| InChIKey | RAWHQDQLXWBICR-IJIBWRBDSA-N |
| XLogP | 5.25 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|