C41H50N4O8 — CID 20765313
ethyl 2-ethenyl-1-[[4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 20765313) has the molecular formula C41H50N4O8 and a molecular weight of 726.87 g/mol. Its IUPAC name is ethyl 2-ethenyl-1-[[4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-ethenyl-1-[[4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20765313 |
| Molecular Formula | C41H50N4O8 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.36 |
| IUPAC Name | ethyl 2-ethenyl-1-[[4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=CCCCC(NC(=O)OC(C)(C)C)C(=O)N1CC(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)CC1C(=O)NC1(C(=O)OCC)CC1C=C |
| InChI | InChI=1S/C41H50N4O8/c1-8-11-13-18-31(43-39(49)53-40(4,5)6)37(47)45-25-29(22-34(45)36(46)44-41(24-27(41)9-2)38(48)51-10-3)52-35-23-32(26-16-14-12-15-17-26)42-33-21-28(50-7)19-20-30(33)35/h8-9,12,14-17,19-21,23,27,29,31,34H,1-2,10-11,13,18,22,24-25H2,3-7H3,(H,43,49)(H,44,46) |
| InChIKey | VMZOOJSUHGSEDH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|