C42H52N4O6 — CID 25006658
ethyl 1-[[(2S,4R)-1-[(2S)-2-cyclohexyl-2-piperidin-1-ylacetyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate (PubChem CID 25006658) has the molecular formula C42H52N4O6 and a molecular weight of 708.90 g/mol. Its IUPAC name is ethyl 1-[[(2S,4R)-1-[(2S)-2-cyclohexyl-2-piperidin-1-ylacetyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[[(2S,4R)-1-[(2S)-2-cyclohexyl-2-piperidin-1-ylacetyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 25006658 |
| Molecular Formula | C42H52N4O6 |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | ethyl 1-[[(2S,4R)-1-[(2S)-2-cyclohexyl-2-piperidin-1-ylacetyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1CC1(NC(=O)[C@@H]1C[C@@H](Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)CN1C(=O)[C@H](C1CCCCC1)N1CCCCC1)C(=O)OCC |
| InChI | InChI=1S/C42H52N4O6/c1-4-30-26-42(30,41(49)51-5-2)44-39(47)36-24-32(27-46(36)40(48)38(29-17-11-7-12-18-29)45-21-13-8-14-22-45)52-37-25-34(28-15-9-6-10-16-28)43-35-23-31(50-3)19-20-33(35)37/h4,6,9-10,15-16,19-20,23,25,29-30,32,36,38H,1,5,7-8,11-14,17-18,21-22,24,26-27H2,2-3H3,(H,44,47)/t30?,32-,36+,38+,42?/m1/s1 |
| InChIKey | SXIQFJLSCSEWES-BKPLNZPSSA-N |
| XLogP | 6.32 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|