C32H44F4N2O2Ti — CID 172802898
bis(N-(2,4-difluorobenzene-3-id-1-yl)decanamide);titanium(2+) (PubChem CID 172802898) has the molecular formula C32H44F4N2O2Ti and a molecular weight of 612.58 g/mol. Its IUPAC name is bis(N-(2,4-difluorobenzene-3-id-1-yl)decanamide);titanium(2+).
| Compound Name | bis(N-(2,4-difluorobenzene-3-id-1-yl)decanamide);titanium(2+) |
|---|---|
| PubChem CID | 172802898 |
| Molecular Formula | C32H44F4N2O2Ti |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | bis(N-(2,4-difluorobenzene-3-id-1-yl)decanamide);titanium(2+) |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(F)[c-]c1F.CCCCCCCCCC(=O)Nc1ccc(F)[c-]c1F.[Ti+2] |
| InChI | InChI=1S/2C16H22F2NO.Ti/c2*1-2-3-4-5-6-7-8-9-16(20)19-15-11-10-13(17)12-14(15)18;/h2*10-11H,2-9H2,1H3,(H,19,20);/q2*-1;+2 |
| InChIKey | FKWYPSWAKCZRJD-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|