C18H15F3N4O3S — CID 172803606
N-[4-(4-methylsulfonylphenyl)-3-pyridin-4-yl-5-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 172803606) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylphenyl)-3-pyridin-4-yl-5-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[4-(4-methylsulfonylphenyl)-3-pyridin-4-yl-5-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 172803606 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[4-(4-methylsulfonylphenyl)-3-pyridin-4-yl-5-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CC(=O)Nn1nc(-c2ccncc2)c(-c2ccc(S(C)(=O)=O)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H15F3N4O3S/c1-11(26)23-25-17(18(19,20)21)15(16(24-25)13-7-9-22-10-8-13)12-3-5-14(6-4-12)29(2,27)28/h3-10H,1-2H3,(H,23,26) |
| InChIKey | REXYVWCYUTXBOH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |