C17H14N3O4S- — CID 19355534
1-methyl-3-(4-methylsulfonylphenyl)-4-pyridin-4-ylpyrazole-5-carboxylate (PubChem CID 19355534) has the molecular formula C17H14N3O4S- and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-methyl-3-(4-methylsulfonylphenyl)-4-pyridin-4-ylpyrazole-5-carboxylate.
| Compound Name | 1-methyl-3-(4-methylsulfonylphenyl)-4-pyridin-4-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19355534 |
| Molecular Formula | C17H14N3O4S- |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-methyl-3-(4-methylsulfonylphenyl)-4-pyridin-4-ylpyrazole-5-carboxylate |
| SMILES | Cn1nc(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccncc2)c1C(=O)[O-] |
| InChI | InChI=1S/C17H15N3O4S/c1-20-16(17(21)22)14(11-7-9-18-10-8-11)15(19-20)12-3-5-13(6-4-12)25(2,23)24/h3-10H,1-2H3,(H,21,22)/p-1 |
| InChIKey | SLICOKJQYNUBRX-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |