C12H11N2O6S2- — CID 162457126
3-(4-methylsulfonylphenyl)-1-sulfamoylpyrrole-2-carboxylate (PubChem CID 162457126) has the molecular formula C12H11N2O6S2- and a molecular weight of 343.36 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-1-sulfamoylpyrrole-2-carboxylate.
| Compound Name | 3-(4-methylsulfonylphenyl)-1-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 162457126 |
| Molecular Formula | C12H11N2O6S2- |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-1-sulfamoylpyrrole-2-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(-c2ccn(S(N)(=O)=O)c2C(=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O6S2/c1-21(17,18)9-4-2-8(3-5-9)10-6-7-14(22(13,19)20)11(10)12(15)16/h2-7H,1H3,(H,15,16)(H2,13,19,20)/p-1 |
| InChIKey | AVWWDAYKKVTWLZ-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |