About 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid
3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid (PubChem CID 166591578) has the molecular formula C15H17N3O7S
and a molecular weight of 383.38 g/mol. Its IUPAC name is 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid |
| PubChem CID | 166591578 |
| Molecular Formula | C15H17N3O7S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid |
| SMILES | NS(=O)(=O)n1ccc(-c2ccc(C(=O)NC[C@@H](O)CO)cc2)c1C(=O)O |
| InChI | InChI=1S/C15H17N3O7S/c16-26(24,25)18-6-5-12(13(18)15(22)23)9-1-3-10(4-2-9)14(21)17-7-11(20)8-19/h1-6,11,19-20H,7-8H2,(H,17,21)(H,22,23)(H2,16,24,25)/t11-/m1/s1 |
| InChIKey | WOLHKQBWYYGJCP-LLVKDONJSA-N |
| XLogP | -1.01 |
| TPSA | 171.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid?
The IUPAC name of 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid (CID 166591578) is 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid.
What is the SMILES notation for 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid?
The canonical SMILES for 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid is NS(=O)(=O)n1ccc(-c2ccc(C(=O)NC[C@@H](O)CO)cc2)c1C(=O)O.
What is the InChIKey of 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid?
The InChIKey is WOLHKQBWYYGJCP-LLVKDONJSA-N. The full InChI is InChI=1S/C15H17N3O7S/c16-26(24,25)18-6-5-12(13(18)15(22)23)9-1-3-10(4-2-9)14(21)17-7-11(20)8-19/h1-6,11,19-20H,7-8H2,(H,17,21)(H,22,23)(H2,16,24,25)/t11-/m1/s1.
What are the key properties of 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid?
3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid has a molecular weight of 383.38 g/mol, XLogP of -1.01, 7 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(2R)-2,3-dihydroxypropyl]carbamoyl]phenyl]-1-sulfamoylpyrrole-2-carboxylic acid is sourced from PubChem (CID 166591578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).