C12H12N2O4S — CID 43324444
1-methyl-3-(4-methylsulfonylphenyl)pyrazole-4-carboxylic acid (PubChem CID 43324444) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-methyl-3-(4-methylsulfonylphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-3-(4-methylsulfonylphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43324444 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-methyl-3-(4-methylsulfonylphenyl)pyrazole-4-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H12N2O4S/c1-14-7-10(12(15)16)11(13-14)8-3-5-9(6-4-8)19(2,17)18/h3-7H,1-2H3,(H,15,16) |
| InChIKey | OQBYDGXWKKSDIX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |