C22H24O4 — CID 172805564
ethyl (3E)-6,6-bis(3-methoxyphenyl)hexa-3,5-dienoate (PubChem CID 172805564) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl (3E)-6,6-bis(3-methoxyphenyl)hexa-3,5-dienoate.
| Compound Name | ethyl (3E)-6,6-bis(3-methoxyphenyl)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 172805564 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl (3E)-6,6-bis(3-methoxyphenyl)hexa-3,5-dienoate |
| SMILES | CCOC(=O)C/C=C/C=C(c1cccc(OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H24O4/c1-4-26-22(23)14-6-5-13-21(17-9-7-11-19(15-17)24-2)18-10-8-12-20(16-18)25-3/h5-13,15-16H,4,14H2,1-3H3/b6-5+ |
| InChIKey | RLOXTVZXKPAZRB-AATRIKPKSA-N |
| XLogP | 4.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|