C22H19FN8 — CID 172807847
3-[4-azido-5-(1-ethylcyclopropyl)pyrimidin-2-yl]-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridine (PubChem CID 172807847) has the molecular formula C22H19FN8 and a molecular weight of 414.45 g/mol. Its IUPAC name is 3-[4-azido-5-(1-ethylcyclopropyl)pyrimidin-2-yl]-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridine.
| Compound Name | 3-[4-azido-5-(1-ethylcyclopropyl)pyrimidin-2-yl]-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 172807847 |
| Molecular Formula | C22H19FN8 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[4-azido-5-(1-ethylcyclopropyl)pyrimidin-2-yl]-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridine |
| SMILES | CCC1(c2cnc(-c3nn(Cc4ccccc4F)c4ncccc34)nc2N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C22H19FN8/c1-2-22(9-10-22)16-12-26-20(27-19(16)28-30-24)18-15-7-5-11-25-21(15)31(29-18)13-14-6-3-4-8-17(14)23/h3-8,11-12H,2,9-10,13H2,1H3 |
| InChIKey | RTJSEVVLHPOZCC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 105.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|