C23H23F3N2O3 — CID 172809675
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[7-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-chromen-4-yl]carbamate (PubChem CID 172809675) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[7-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-chromen-4-yl]carbamate.
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[7-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-chromen-4-yl]carbamate |
|---|---|
| PubChem CID | 172809675 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[7-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-chromen-4-yl]carbamate |
| SMILES | O=C(NC1CCOc2cc(-c3ccc(F)c(F)c3F)ccc21)O[C@@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C23H23F3N2O3/c24-17-4-3-15(21(25)22(17)26)14-1-2-16-18(7-10-30-19(16)11-14)27-23(29)31-20-12-28-8-5-13(20)6-9-28/h1-4,11,13,18,20H,5-10,12H2,(H,27,29)/t18?,20-/m1/s1 |
| InChIKey | RZPKGENKSSZEHC-ROPPNANJSA-N |
| XLogP | 4.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|