C10H14N2O2S — CID 172812475
(2S)-2-amino-2-methyl-4-pyridin-2-ylsulfanylbutanoic acid (PubChem CID 172812475) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is (2S)-2-amino-2-methyl-4-pyridin-2-ylsulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-2-methyl-4-pyridin-2-ylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 172812475 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2S)-2-amino-2-methyl-4-pyridin-2-ylsulfanylbutanoic acid |
| SMILES | C[C@](N)(CCSc1ccccn1)C(=O)O |
| InChI | InChI=1S/C10H14N2O2S/c1-10(11,9(13)14)5-7-15-8-4-2-3-6-12-8/h2-4,6H,5,7,11H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | SJGGAFYDTXLXTK-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |