arsorous acid;phosphoric acid

H6AsO7P — CID 172816353

IUPACarsorous acid;phosphoric acid
SMILESO=P(O)(O)O.O[As](O)O
InChIInChI=1S/AsH3O3.H3O4P/c2-1(3)4;1-5(2,3)4/h2-4H;(H3,1,2,3,4)
InChIKeySWBOXQIXDMTDSK-UHFFFAOYSA-N
MW223.94 g/mol
LogP-2.98
Rot. Bonds

About arsorous acid;phosphoric acid

arsorous acid;phosphoric acid (PubChem CID 172816353) has the molecular formula H6AsO7P and a molecular weight of 223.94 g/mol. Its IUPAC name is arsorous acid;phosphoric acid.

Molecular Properties

Compound Namearsorous acid;phosphoric acid
PubChem CID172816353
Molecular FormulaH6AsO7P
Molecular Weight223.94 g/mol
Exact Mass223.91
IUPAC Namearsorous acid;phosphoric acid
SMILESO=P(O)(O)O.O[As](O)O
InChIInChI=1S/AsH3O3.H3O4P/c2-1(3)4;1-5(2,3)4/h2-4H;(H3,1,2,3,4)
InChIKeySWBOXQIXDMTDSK-UHFFFAOYSA-N
XLogP-2.98
TPSA138.45 Ų
H-Bond Donors6
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500223.94
LogP ≤ 5-2.98
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze arsorous acid;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methane;phosphoric acid
CID 18515646
phosphane;phosphoric acid
CID 172840180
phosphoric acid;hydrate
CID 22023151
hydrogen peroxide;phosphoric acid
CID 18509931
CID 159816390
CID 159816390
iron;phosphoric acid
CID 174838016
methane;phosphoric acid
CID 173400304
cerium;phosphoric acid
CID 90659592
CID 173050648
CID 173050648
phosphane;phosphoric acid
CID 173160232
phosphoric acid;zinc
CID 173400996
phosphoric acid;xenon
CID 159732465

Frequently Asked Questions

What is the IUPAC name of arsorous acid;phosphoric acid?
The IUPAC name of arsorous acid;phosphoric acid (CID 172816353) is arsorous acid;phosphoric acid.
What is the SMILES notation for arsorous acid;phosphoric acid?
The canonical SMILES for arsorous acid;phosphoric acid is O=P(O)(O)O.O[As](O)O.
What is the InChIKey of arsorous acid;phosphoric acid?
The InChIKey is SWBOXQIXDMTDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/AsH3O3.H3O4P/c2-1(3)4;1-5(2,3)4/h2-4H;(H3,1,2,3,4).
What are the key properties of arsorous acid;phosphoric acid?
arsorous acid;phosphoric acid has a molecular weight of 223.94 g/mol, XLogP of -2.98, 0 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for arsorous acid;phosphoric acid is sourced from PubChem (CID 172816353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).