C18H19FN2O3 — CID 172816845
2-(4-butoxy-2-fluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 172816845) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(4-butoxy-2-fluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 2-(4-butoxy-2-fluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 172816845 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(4-butoxy-2-fluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | CCCCOc1ccc(-c2c(C(N)=O)cccc2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C18H19FN2O3/c1-2-3-9-24-11-7-8-12(15(19)10-11)16-13(17(20)22)5-4-6-14(16)18(21)23/h4-8,10H,2-3,9H2,1H3,(H2,20,22)(H2,21,23) |
| InChIKey | SXOKWCPHSWSWCT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|