About 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride
2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride (PubChem CID 172818136) has the molecular formula C18H29Cl2N3O
and a molecular weight of 374.36 g/mol. Its IUPAC name is 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride |
| PubChem CID | 172818136 |
| Molecular Formula | C18H29Cl2N3O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride |
| SMILES | CC(C)CCc1nc2ccc(C(N)=O)cc2n1CCC(C)C.Cl.Cl |
| InChI | InChI=1S/C18H27N3O.2ClH/c1-12(2)5-8-17-20-15-7-6-14(18(19)22)11-16(15)21(17)10-9-13(3)4;;/h6-7,11-13H,5,8-10H2,1-4H3,(H2,19,22);2*1H |
| InChIKey | TVSKXXWFFQWXQI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride?
The IUPAC name of 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride (CID 172818136) is 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride.
What is the SMILES notation for 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride?
The canonical SMILES for 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride is CC(C)CCc1nc2ccc(C(N)=O)cc2n1CCC(C)C.Cl.Cl.
What is the InChIKey of 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride?
The InChIKey is TVSKXXWFFQWXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O.2ClH/c1-12(2)5-8-17-20-15-7-6-14(18(19)22)11-16(15)21(17)10-9-13(3)4;;/h6-7,11-13H,5,8-10H2,1-4H3,(H2,19,22);2*1H.
What are the key properties of 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride?
2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride has a molecular weight of 374.36 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride is sourced from PubChem (CID 172818136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).