C18H29Cl2N3O — CID 172818136
2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride (PubChem CID 172818136) has the molecular formula C18H29Cl2N3O and a molecular weight of 374.36 g/mol. Its IUPAC name is 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 172818136 |
| Molecular Formula | C18H29Cl2N3O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2,3-bis(3-methylbutyl)benzimidazole-5-carboxamide;dihydrochloride |
| SMILES | CC(C)CCc1nc2ccc(C(N)=O)cc2n1CCC(C)C.Cl.Cl |
| InChI | InChI=1S/C18H27N3O.2ClH/c1-12(2)5-8-17-20-15-7-6-14(18(19)22)11-16(15)21(17)10-9-13(3)4;;/h6-7,11-13H,5,8-10H2,1-4H3,(H2,19,22);2*1H |
| InChIKey | TVSKXXWFFQWXQI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |