2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid

C16H22N2O2 — CID 62336746

IUPAC2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid
SMILESCc1cc2nc(CCC(C)C)n(CC(=O)O)c2cc1C
InChIInChI=1S/C16H22N2O2/c1-10(2)5-6-15-17-13-7-11(3)12(4)8-14(13)18(15)9-16(19)20/h7-8,10H,5-6,9H2,1-4H3,(H,19,20)
InChIKeyGLSVCHIFGXXWPJ-UHFFFAOYSA-N
MW274.36 g/mol
LogP3.33
Rot. Bonds5

About 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid

2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid (PubChem CID 62336746) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid
PubChem CID62336746
Molecular FormulaC16H22N2O2
Molecular Weight274.36 g/mol
Exact Mass274.17
IUPAC Name2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid
SMILESCc1cc2nc(CCC(C)C)n(CC(=O)O)c2cc1C
InChIInChI=1S/C16H22N2O2/c1-10(2)5-6-15-17-13-7-11(3)12(4)8-14(13)18(15)9-16(19)20/h7-8,10H,5-6,9H2,1-4H3,(H,19,20)
InChIKeyGLSVCHIFGXXWPJ-UHFFFAOYSA-N
XLogP3.33
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 53.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid?
The IUPAC name of 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid (CID 62336746) is 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid.
What is the SMILES notation for 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid?
The canonical SMILES for 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid is Cc1cc2nc(CCC(C)C)n(CC(=O)O)c2cc1C.
What is the InChIKey of 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid?
The InChIKey is GLSVCHIFGXXWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-10(2)5-6-15-17-13-7-11(3)12(4)8-14(13)18(15)9-16(19)20/h7-8,10H,5-6,9H2,1-4H3,(H,19,20).
What are the key properties of 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid?
2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid has a molecular weight of 274.36 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid is sourced from PubChem (CID 62336746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).