C16H22N2O2 — CID 62336746
2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid (PubChem CID 62336746) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 62336746 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-[5,6-dimethyl-2-(3-methylbutyl)benzimidazol-1-yl]acetic acid |
| SMILES | Cc1cc2nc(CCC(C)C)n(CC(=O)O)c2cc1C |
| InChI | InChI=1S/C16H22N2O2/c1-10(2)5-6-15-17-13-7-11(3)12(4)8-14(13)18(15)9-16(19)20/h7-8,10H,5-6,9H2,1-4H3,(H,19,20) |
| InChIKey | GLSVCHIFGXXWPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |