C14H15FO4 — CID 172820169
3-ethyl-6-(4-fluorophenyl)-2,4-dioxohexanoic acid (PubChem CID 172820169) has the molecular formula C14H15FO4 and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-ethyl-6-(4-fluorophenyl)-2,4-dioxohexanoic acid.
| Compound Name | 3-ethyl-6-(4-fluorophenyl)-2,4-dioxohexanoic acid |
|---|---|
| PubChem CID | 172820169 |
| Molecular Formula | C14H15FO4 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-ethyl-6-(4-fluorophenyl)-2,4-dioxohexanoic acid |
| SMILES | CCC(C(=O)CCc1ccc(F)cc1)C(=O)C(=O)O |
| InChI | InChI=1S/C14H15FO4/c1-2-11(13(17)14(18)19)12(16)8-5-9-3-6-10(15)7-4-9/h3-4,6-7,11H,2,5,8H2,1H3,(H,18,19) |
| InChIKey | UCSQPEXXGKZCLM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|