C18H22F2N6O2 — CID 172825051
4-(difluoromethyl)-3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)pyridin-2-amine (PubChem CID 172825051) has the molecular formula C18H22F2N6O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)pyridin-2-amine.
| Compound Name | 4-(difluoromethyl)-3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 172825051 |
| Molecular Formula | C18H22F2N6O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-(difluoromethyl)-3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)pyridin-2-amine |
| SMILES | Nc1nccc(C(F)F)c1-c1cc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H22F2N6O2/c19-16(20)12-1-2-22-17(21)15(12)13-11-14(25-3-7-27-8-4-25)24-18(23-13)26-5-9-28-10-6-26/h1-2,11,16H,3-10H2,(H2,21,22) |
| InChIKey | UTAUNEGBVZCDBS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |