C10H12NNaO3 — CID 172826059
sodium 3-(2-methylpropoxy)pyridine-4-carboxylate (PubChem CID 172826059) has the molecular formula C10H12NNaO3 and a molecular weight of 217.20 g/mol. Its IUPAC name is sodium 3-(2-methylpropoxy)pyridine-4-carboxylate.
| Compound Name | sodium 3-(2-methylpropoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 172826059 |
| Molecular Formula | C10H12NNaO3 |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | sodium 3-(2-methylpropoxy)pyridine-4-carboxylate |
| SMILES | CC(C)COc1cnccc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H13NO3.Na/c1-7(2)6-14-9-5-11-4-3-8(9)10(12)13;/h3-5,7H,6H2,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | UWLQAOGLNQVYDW-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |