About 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide
3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide (PubChem CID 172827674) has the molecular formula C10H21BrN2O
and a molecular weight of 265.19 g/mol. Its IUPAC name is 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide.
Molecular Properties
| Compound Name | 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide |
| PubChem CID | 172827674 |
| Molecular Formula | C10H21BrN2O |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide |
| SMILES | CCCOCCC.C[n+]1cc[nH]c1.[Br-] |
| InChI | InChI=1S/C6H14O.C4H6N2.BrH/c1-3-5-7-6-4-2;1-6-3-2-5-4-6;/h3-6H2,1-2H3;2-4H,1H3;1H |
| InChIKey | VCBCJGGXYDSUQW-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 28.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide?
The IUPAC name of 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide (CID 172827674) is 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide.
What is the SMILES notation for 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide?
The canonical SMILES for 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide is CCCOCCC.C[n+]1cc[nH]c1.[Br-].
What is the InChIKey of 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide?
The InChIKey is VCBCJGGXYDSUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C4H6N2.BrH/c1-3-5-7-6-4-2;1-6-3-2-5-4-6;/h3-6H2,1-2H3;2-4H,1H3;1H.
What are the key properties of 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide?
3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide has a molecular weight of 265.19 g/mol, XLogP of -1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-imidazol-3-ium;1-propoxypropane;bromide is sourced from PubChem (CID 172827674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).