About heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride
heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride (PubChem CID 172737885) has the molecular formula C24H47ClN2O3
and a molecular weight of 447.10 g/mol. Its IUPAC name is heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride.
Molecular Properties
| Compound Name | heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride |
| PubChem CID | 172737885 |
| Molecular Formula | C24H47ClN2O3 |
| Molecular Weight | 447.10 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride |
| SMILES | CCCCCCCCCCCCCCCCCOC(=O)CCO.C[n+]1cc[nH]c1.[Cl-] |
| InChI | InChI=1S/C20H40O3.C4H6N2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23-20(22)17-18-21;1-6-3-2-5-4-6;/h21H,2-19H2,1H3;2-4H,1H3;1H |
| InChIKey | IRPFOLDJYCXMHI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride?
The IUPAC name of heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride (CID 172737885) is heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride.
What is the SMILES notation for heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride?
The canonical SMILES for heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride is CCCCCCCCCCCCCCCCCOC(=O)CCO.C[n+]1cc[nH]c1.[Cl-].
What is the InChIKey of heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride?
The InChIKey is IRPFOLDJYCXMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3.C4H6N2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23-20(22)17-18-21;1-6-3-2-5-4-6;/h21H,2-19H2,1H3;2-4H,1H3;1H.
What are the key properties of heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride?
heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride has a molecular weight of 447.10 g/mol, XLogP of 2.63, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecyl 3-hydroxypropanoate;3-methyl-1H-imidazol-3-ium;chloride is sourced from PubChem (CID 172737885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).