C11H17ClN4O2 — CID 172829952
methyl 5-(piperidin-4-ylamino)pyrazine-2-carboxylate;hydrochloride (PubChem CID 172829952) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is methyl 5-(piperidin-4-ylamino)pyrazine-2-carboxylate;hydrochloride.
| Compound Name | methyl 5-(piperidin-4-ylamino)pyrazine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 172829952 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl 5-(piperidin-4-ylamino)pyrazine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cnc(NC2CCNCC2)cn1.Cl |
| InChI | InChI=1S/C11H16N4O2.ClH/c1-17-11(16)9-6-14-10(7-13-9)15-8-2-4-12-5-3-8;/h6-8,12H,2-5H2,1H3,(H,14,15);1H |
| InChIKey | VJMNIPAPYLWDQD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |